Olein turşusu(tsis 9-oktadetsen turşusu)СН3(СН2)7СН=СН(СН2)7СООН -doymamış yağ turşusudır. Omega-9 doymamış yağ turşular qrupuna aiddir.

Olein
Oleic-acid-skeletal.svg
Oleic-acid-3D-vdW.png
Ümumi
Sistematik adı tsis 9-oktadetsen turşusu
Kimyəvi formulu C₁₈H₃₄O₂[1]
Molyar kütlə 282,46 q/mol
Fiziki xassələri
Sıxlıq 0,895 (18°C, г/см3) q/sm³
Termik xüsusiyyətlər
Ərimə nöqtəsi 16,3 °S
Qaynama nöqtəsi 360 °C; при 10 мм рт. ст.: 225—226 °S
Təsnifatı
CAS-da qeyd. nöm. 112-80-1
PubChem
SMILES CCCCCCCC\C=C/CCCCCCCC(O)=O
RTECS RG2275000
ChEBI 16196
ChemSpider


Fiziki xassələriRedaktə

Olein turşusu yağlı mayedir, sudan yüngüldür, qoxusuz, rəngsiz, suda həll olunmur, yalnız üzvi həlledicilərdə həll olunur (benzolda, xloroformda və s.).

AlınmasıRedaktə

Texniki olein turşusu müxtəlif bitki yağlarının hidrolizi zamanı alınır, məsələn, günəbaxan, soya və ya xardal. Bu məhsul qida məqsədləri üçün tamamilə yararsızdır. Alınan turşuları fraksiyalara ayırmaqla və ya metanoldan və asetondan–400C temperaturda təkrar kristallaş- dırılma yolu ilə əldə edilə bilər. Təbiətdə müxtəlif heyvan mənşəli piylərin tərkibində olur məs. donuz, mal piyində həmçinin bitki yağlarındada (zeytun, badam, günəbaxan,avokado,palma, arqan və s. ).

Kimyəvi xassələriRedaktə

Olein turşusuna ozonla təsiri nəticəsində ozonid alınır. Kalium permanqanatla qələvi mühitində oksidləşəndə pelarqon СН3—(СН2)7—СООН və azelain НООС—(СН2)7—СООН turşusu alınır. Stearin turşusuna qədər hidritləşir. Olein turşusunun qələvi metal duzları suda çox yaxşı həll olunur və toxuculuq sənayesində istifadə olunurlar (olein sabunu). Olein turşusunun qurğuşun duzu, doymuş yağ turşularının qurğuşun duzlarından fərqli olaraq, efirlərdə həll olunur, bu fərqə əsaslanaraq təbii yağların sabunlaşması nəticəsində alınan turşuların qarışığından olein turşusununu ayırmaq olur.

TətbiqiRedaktə

Olein turşusu və onun efirləri boyalar və laklar istehsalı üçün istifadə olunur.Sabun hazırlanmasında geniş tətbiq olunur. Olein turşusu və duzları emulqator kimi geniş istifadə olunur, xüsusəndə yağlayıcı-soyuducu mayelərin tərkibində metal kəsmə əməliyyatları zamanı. Olein turşusu qida sənayesindədə dad verən vasitə kimi istifadə olunur.

TəhlükəsliyiRedaktə

Olein turşusu insan dərisi üçün zərərsizdir, suda həll olunmur. Çıxarılması üçün spirt, aseton, xloroform, efirdən istifadə etmək olar. İstifadə etdikdə hava ilə oksidləşir və rənqi qaralır. Bunu nəzərə alaraq olein turşusu sıx bağlı bir qabda saxlanılmalıdır.

MənbəRedaktə

  1. Рабинович В. А., Хавин З. Я. «Краткий химический справочник» Л.: Химия, 1977 стр. 170
  2. Гауптман 3., Грефе Ю., Ремане X., Органическая химия, пер. с нем., М., 1979
  1. oleic acid (ing.).