"Ftaleinlər" səhifəsinin versiyaları arasındakı fərqlər

562 bayt əlavə edildi ,  2 il öncə
Düzəlişin təsviri yoxdur.
k (Kateqoriya:Boyaqlar əlavə olundu HotCat ilə)
{{Maddə
| şəkil = Phenolphthalein.png
| şəkil3D = Sample of solid phenolphthalein.jpg
| kimy. formulu = C<sub>20</sub>H<sub>14</sub>O<sub>4</sub>
| molyar kütlə = 318,31
 
| sıxlıq = 1,3
 
| ərimə temp. = 261—263
 
| CAS = 77-09-8
| EINECS =
| SMILES = Oc1ccc(cc1)C3(OC(=O)c2ccccc23)c4ccc(O)cc4
| ЕС =
| RTECS =
 
| ЛД50 =
}}
'''Ftaleinlər'''-ftal anhidridindən alınan boyaqlardır.
== Xassələri ==