Adrenoqlomerulotropin

Adrenoqlomerulotropin yun. "ad-"("ak-", "at-", "yaxınlıq")epifizdən ifraz olunan üç hormondan biridir. Bu hormonun adı 1959-cu ildə Qordon Farellom tərəfindən təklif olunmuşdu. Adrenoqlomerulotropin melatonin hormonunun biotransformasiyasında mühüm rol oynayır.[1]

Adrenoqlomerulotropin
6-MeO-THH.png
Serotonin-Spartan-HF-based-on-xtal-3D-sf-web.png
Ümumi
Kimyəvi formulu C13H16N2O
Molyar kütlə 216,278 q/mol
Termik xüsusiyyətlər
Ərimə nöqtəsi 150-151 °S
Təsnifatı
CAS-da qeyd. nöm. 1210-56-6
PubChem
SMILES CC1C2=C(CCN1)C3=C(N2)C=CC(=C3)OC
ChemSpider

İstinadlarRedaktə